CAS 81153-35-7

1,6,8-trimethyl-1,2,3,6-tetrahydrodipyrazolo[3,4-b:3,4-d]pyridin-3-one

Description:

1,6,8-Trimethyl-1,2,3,6-tetrahydrodipyrazolo[3,4-b:3,4-d]pyridin-3-one is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates two pyrazole rings fused to a pyridine moiety. This compound features multiple methyl groups at the 1, 6, and 8 positions, contributing to its unique chemical properties and potential biological activity. The presence of the tetrahydro configuration indicates that the compound is saturated, which can influence its reactivity and stability. It is often studied for its potential applications in medicinal chemistry, particularly due to the presence of nitrogen-containing rings that can interact with biological targets. The compound's CAS number, 81153-35-7, allows for its identification in chemical databases and literature. Its solubility, melting point, and specific reactivity would depend on the surrounding conditions and the presence of functional groups. Overall, this compound represents a class of nitrogen-rich heterocycles that are of interest in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₀H₁₁N₅O

InChI: InChI=1/C10H11N5O/c1-5-7-8-6(10(16)13-14(8)2)4-11-9(7)15(3)12-5/h4H,1-3H3,(H,13,16)

SMILES: Cc1c2c3c(cnc2n(C)n1)c(nn3C)O

Synonyms:

• 1,6,8-trimethyl-1,6-dihydrodipyrazolo[3,4-b:3',4'-d]pyridin-3(2H)-one

1,6,8-trimethyl-1,2,3,6-tetrahydrodipyrazolo[3,4-b:3,4-d]pyridin-3-one

CAS: 81153-35-7

1,6,8-trimethyl-1,2,3,6-tetrahydrodipyrazolo[3,4-b:3,4-d]pyridin-3-one

Purity: ≥95%

Molecular weight: 217.23g/mol

Ref: 54-OR25678