CAS 81154-17-8
:(5Z)-5-[(4-Methoxyphenyl)methylene]-2-thioxo-4-thiazolidinone
Description:
(5Z)-5-[(4-Methoxyphenyl)methylene]-2-thioxo-4-thiazolidinone, with CAS number 81154-17-8, is a thiazolidinone derivative characterized by its thiazolidine ring structure, which includes a thione (sulfur-containing) functional group. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, reflecting its aromatic and heterocyclic nature. The presence of the methoxyphenyl group contributes to its potential for various biological activities, including antimicrobial and anti-inflammatory properties. The thiazolidinone core is known for its ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit stability under standard laboratory conditions, although specific reactivity can depend on environmental factors such as pH and temperature. Its unique structure allows for potential modifications, which can lead to the development of new derivatives with enhanced pharmacological profiles. Overall, this compound represents a significant area of study in the field of organic and medicinal chemistry.
Formula:C11H9NO2S2
InChI:InChI=1S/C11H9NO2S2/c1-14-8-4-2-7(3-5-8)6-9-10(13)12-11(15)16-9/h2-6H,1H3,(H,12,13,15)/b9-6-
InChI key:InChIKey=ORGCJYCWFZQEFX-TWGQIWQCSA-N
SMILES:C(=C\1/C(=O)NC(=S)S1)\C2=CC=C(OC)C=C2
Synonyms:- (Z)-5-(4-Methoxybenzylidene)-2-thioxothiazolidin-4-one
- 4-Thiazolidinone, 5-[(4-methoxyphenyl)methylene]-2-thioxo-, (Z)-
- (5Z)-5-[(4-Methoxyphenyl)methylene]-2-thioxo-4-thiazolidinone
- 4-Thiazolidinone, 5-[(4-methoxyphenyl)methylene]-2-thioxo-, (5Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.