CAS 81156-88-9
:1-(2-methylprop-1-en-1-yl)azetidine
Description:
1-(2-Methylprop-1-en-1-yl)azetidine, with the CAS number 81156-88-9, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. This compound features a substituent group, specifically a 2-methylprop-1-en-1-yl group, which introduces unsaturation and contributes to its reactivity. The presence of the double bond in the substituent enhances its potential for various chemical reactions, such as addition or polymerization. The azetidine ring itself is known for its strain due to the small ring size, which can influence the compound's stability and reactivity. Additionally, 1-(2-methylprop-1-en-1-yl)azetidine may exhibit unique physical properties, such as boiling and melting points, which are influenced by its molecular structure and functional groups. This compound may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex molecules. Its specific characteristics, including solubility and reactivity, would depend on the surrounding conditions and the presence of other functional groups.
Formula:C7H13N
InChI:InChI=1/C7H13N/c1-7(2)6-8-4-3-5-8/h6H,3-5H2,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.