CAS 81161-89-9
:thr-tyr-ser
Description:
The chemical substance known as "thr-tyr-ser," with the CAS number 81161-89-9, is a tripeptide composed of three amino acids: threonine (Thr), tyrosine (Tyr), and serine (Ser). This peptide is characterized by its specific sequence of amino acids, which influences its biological activity and properties. Tripeptides like thr-tyr-ser can exhibit various functions in biological systems, including acting as signaling molecules, participating in metabolic processes, or serving as precursors for larger proteins. The presence of hydroxyl groups in threonine and serine contributes to the peptide's hydrophilicity, potentially affecting its solubility in aqueous environments. Additionally, the aromatic side chain of tyrosine may allow for interactions with other biomolecules, influencing its role in biochemical pathways. Overall, the characteristics of thr-tyr-ser are determined by the unique combination of its constituent amino acids, which dictate its structure, function, and potential applications in fields such as biochemistry and pharmacology.
Formula:C16H23N3O7
InChI:InChI=1/C16H23N3O7/c1-8(21)13(17)15(24)18-11(6-9-2-4-10(22)5-3-9)14(23)19-12(7-20)16(25)26/h2-5,8,11-13,20-22H,6-7,17H2,1H3,(H,18,24)(H,19,23)(H,25,26)
SMILES:CC(C(C(=NC(Cc1ccc(cc1)O)C(=NC(CO)C(=O)O)O)O)N)O
Synonyms:- H-Thr-Tyr-Ser-OH
- Threonyltyrosylserine
- threonine-threonine-serine
- 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoic acid
- thr-tyr-ser
- THR--SER(THR-TYR-SER)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
H-Thr-Tyr-Ser-OH
CAS:H-Thr-Tyr-Ser-OH is a fluorescent peptide with conjugates that has been shown to be sequestered in atherosclerotic lesions. The fluorescence of this peptide is increased when bound to lipofuscin, which accumulates in atherosclerotic lesions. Immunohistochemical staining has revealed that H-Thr-Tyr-Ser-OH is a marker for the identification of atheromas and can be used to identify areas of lipid accumulation. H-Thr-Tyr-Ser-OH binds to peroxidases and enzyme linked immunosorbent assay (ELISA) antibodies, making it useful as an indicator for the presence of these enzymes. This peptide also stains positively for markers such as CD11b, CD68, and lysozyme.Formula:C16H23N3O7Purity:Min. 95%Molecular weight:369.37 g/mol
