CAS 81171-22-4
:1-Methylethyl 2-hydroxyethanesulfonate
Description:
1-Methylethyl 2-hydroxyethanesulfonate, also known by its CAS number 81171-22-4, is an organic compound characterized by the presence of a sulfonate group, which imparts unique properties to the molecule. This compound features a hydroxy group (-OH) attached to a two-carbon chain, contributing to its solubility in polar solvents, such as water. The presence of the sulfonate group enhances its ionic character, making it useful in various applications, including as a surfactant or in biochemical processes. Its structure suggests potential reactivity, particularly in nucleophilic substitution reactions due to the sulfonate moiety. Additionally, the compound may exhibit biological activity, which could be relevant in pharmaceutical or agricultural contexts. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks. Overall, 1-Methylethyl 2-hydroxyethanesulfonate is a versatile compound with applications in both industrial and research settings.
Formula:C5H12O4S
InChI:InChI=1S/C5H12O4S/c1-5(2)9-10(7,8)4-3-6/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=RFUZTYJDFJDIKZ-UHFFFAOYSA-N
SMILES:O(S(CCO)(=O)=O)C(C)C
Synonyms:- Ethanesulfonic acid, 2-hydroxy-, 1-methylethyl ester
- 1-Methylethyl 2-hydroxyethanesulfonate
- Isopropyl isethionate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
