CAS 811711-33-8

1,2-Dibromo-3-fluorobenzene

Description:

1,2-Dibromo-3-fluorobenzene is an aromatic halogenated compound characterized by the presence of two bromine atoms and one fluorine atom attached to a benzene ring. The molecular structure features a benzene core with the bromine substituents located at the 1 and 2 positions, and the fluorine at the 3 position, leading to a specific arrangement that influences its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits moderate polarity due to the electronegative halogen atoms, which can affect its solubility in various solvents. 1,2-Dibromo-3-fluorobenzene is used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its reactivity is influenced by the presence of the halogens, making it susceptible to nucleophilic substitution reactions. Safety precautions are necessary when handling this compound, as halogenated aromatics can be toxic and environmentally persistent.

Formula: C₆H₃Br₂F

InChI: InChI=1/C6H3Br2F/c7-4-2-1-3-5(9)6(4)8/h1-3H

SMILES: c1cc(c(c(c1)F)Br)Br

Synonyms:

• Benzene, 1,2-Dibromo-3-Fluoro-
• 2,3-Dibromofluorobenzene

1,2-Dibromo-3-fluoro-benzene

CAS: 811711-33-8

Formula: C₆H₃Br₂F

Purity: 98%

Color and Shape: Liquid

Molecular weight: 253.8944

Ref: IN-DA00G3YP

2,3-Dibromofluorobenzene

CAS: 811711-33-8

2,3-Dibromofluorobenzene

Formula: C₆H₃Br₂F

Purity: 98%

Color and Shape: orange liquid

Molecular weight: 253.89g/mol

Ref: 54-PC9919

2,3-Dibromofluorobenzene

CAS: 811711-33-8

Formula: C₆H₃Br₂F

Purity: 95.0%

Color and Shape: Low Melting Solid

Molecular weight: 253.896

Ref: 10-F061589