CAS 81177-55-1

(2R)-2-Aminononanoic acid

Description:

(2R)-2-Aminononanoic acid, also known as nonan-2-amine-1-carboxylic acid, is an amino acid characterized by its aliphatic chain and the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH). This compound features a nine-carbon backbone, with the amino group located on the second carbon, which contributes to its chirality, specifically the R configuration. As a result, it can participate in various biochemical processes, including protein synthesis and metabolic pathways. The presence of the amino and carboxylic acid functional groups allows it to act as a zwitterion in solution, exhibiting both acidic and basic properties. This compound is soluble in water due to its polar functional groups, making it relevant in biological systems. Additionally, (2R)-2-Aminononanoic acid may have applications in pharmaceuticals, biochemistry, and as a potential building block for peptide synthesis. Its unique structure and properties make it a subject of interest in both research and industrial applications.

Formula: C₉H₁₉NO₂

InChI: InChI=1S/C9H19NO2/c1-2-3-4-5-6-7-8(10)9(11)12/h8H,2-7,10H2,1H3,(H,11,12)/t8-/m1/s1

InChI key: InChIKey=JVPFOKXICYJJSC-MRVPVSSYSA-N

SMILES: C([C@H](C(O)=O)N)CCCCCC

Synonyms:

• (2R)-2-Aminononanoic acid
• Nonanoic acid, 2-amino-, (2R)-
• Nonanoic acid, 2-amino-, (R)-