CAS 81189-92-6

(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-(Acetyloxy)tetrahydro-6-oxo-2H-pyran-2-yl]ethyl]-1,2,3,7,8,8a-hexahydro-3,7-dimethyl-1-naphthalenyl (2S)-2-methylbutanoate

Description:

The chemical substance with the name "(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-(Acetyloxy)tetrahydro-6-oxo-2H-pyran-2-yl]ethyl]-1,2,3,7,8,8a-hexahydro-3,7-dimethyl-1-naphthalenyl (2S)-2-methylbutanoate" and CAS number "81189-92-6" is a complex organic compound characterized by its multi-ring structure and specific stereochemistry. It features a naphthalene core, which contributes to its aromatic properties, and includes various functional groups such as an acetyloxy moiety and a tetrahydropyran ring. The presence of multiple chiral centers indicates that the compound can exist in different stereoisomeric forms, which may influence its biological activity and interactions. This compound is likely to exhibit moderate to high lipophilicity due to its hydrophobic naphthalene structure, which can affect its solubility in organic solvents and its behavior in biological systems. Additionally, the presence of ester functional groups suggests potential reactivity in hydrolysis or transesterification reactions. Overall, this compound's structural complexity and stereochemistry may contribute to its potential applications in pharmaceuticals or as a chemical intermediate.

Formula: C₂₆H₃₈O₆

InChI: InChI=1S/C26H38O6/c1-6-16(3)26(29)32-23-12-15(2)11-19-8-7-17(4)22(25(19)23)10-9-20-13-21(30-18(5)27)14-24(28)31-20/h7-8,11,15-17,20-23,25H,6,9-10,12-14H2,1-5H3/t15-,16-,17-,20+,21+,22-,23-,25-/m0/s1

InChI key: InChIKey=OYNSFDWALRRTFU-QQVNEASTSA-N

SMILES: O(C([C@H](CC)C)=O)[C@@H]1[C@]2(C(C=C[C@H](C)[C@@H]2CC[C@@H]3C[C@@H](OC(C)=O)CC(=O)O3)=C[C@H](C)C1)[H]

Synonyms:

• (1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-(Acetyloxy)tetrahydro-6-oxo-2H-pyran-2-yl]ethyl]-1,2,3,7,8,8a-hexahydro-3,7-dimethyl-1-naphthalenyl (2S)-2-methylbutanoate
• Butanoic acid, 2-methyl-, (1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-(acetyloxy)tetrahydro-6-oxo-2H-pyran-2-yl]ethyl]-1,2,3,7,8,8a-hexahydro-3,7-dimethyl-1-naphthalenyl ester, (2S)-
• 4′-O-Acetyllovastatin
• Lovastatin acetate

Acetyllovastatin

CAS: 81189-92-6

Ref: 7W-GP1584

Acetyl Lovastatin

CAS: 81189-92-6

Formula: C₂₆H₃₈O₆

Molecular weight: 446.58

Ref: 4Z-L-1221

Acetyllovastatin

CAS: 81189-92-6

Acetyllovastatin inhibits acetylcholinesterase (IC50: 79 μg/mL), has antifungal properties, and hinders cancer cell growth.

Formula: C₂₆H₃₈O₆

Color and Shape: Solid

Molecular weight: 446.58

Ref: TM-T10235

Acetyllovastatin

CAS: 81189-92-6

Acetyllovastatin is a semi-synthetic derivative of lovastatin, which is a member of the statin class of pharmaceuticals. It is derived from the natural product lovastatin, originally isolated from the mold Aspergillus terreus, through acetylation to enhance its pharmacological properties. The mode of action of acetyllovastatin involves the inhibition of HMG-CoA reductase, a key enzyme in the mevalonate pathway responsible for cholesterol biosynthesis. By competitively inhibiting this enzyme, acetyllovastatin effectively reduces intracellular cholesterol levels, leading to upregulation of LDL receptors and increased clearance of low-density lipoprotein (LDL) from the bloodstream.

Formula: C₂₆H₃₈O₆

Purity: Min. 95%

Molecular weight: 446.6 g/mol

Ref: 3D-GDA18992

Acetyl Lovastatin

CAS: 81189-92-6

Formula: C₂₆H₃₈O₆

Molecular weight: 446.58

Ref: ST-EA-CP-L76026