CymitQuimica logo

CAS 81196-09-0

:

2-(4-Aminophenyl)-3-tert-butoxy-3-oxopropanoic acid

Description:
2-(4-Aminophenyl)-3-tert-butoxy-3-oxopropanoic acid, with the CAS number 81196-09-0, is an organic compound characterized by its complex structure that includes an aminophenyl group, a tert-butoxy moiety, and a keto acid functional group. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the tert-butoxy group contributes to its hydrophobic characteristics, while the amino group can engage in various chemical reactions, including nucleophilic substitutions. The oxo group indicates the presence of a carbonyl, which can influence reactivity and stability. This compound may be of interest in pharmaceutical research due to its potential biological activity, particularly in the development of drugs targeting specific pathways. Its synthesis and application would require careful consideration of its reactivity and the conditions under which it is handled, given the presence of functional groups that can participate in various chemical reactions.
Formula:C13H17NO4
InChI:InChI=1/C13H17NO4/c1-13(2,3)18-12(17)10(11(15)16)8-4-6-9(14)7-5-8/h4-7,10H,14H2,1-3H3,(H,15,16)
InChI key:ZXYKUPPWJMOKGE-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)C(c1ccc(cc1)N)C(=O)O
Synonyms:
  • Boc-(4-aminophenyl)acetic acid
Found 5 products.