CAS 81198-18-7
:7-fluoro-2,5-dihydro-3H-indeno[1,2-c]pyridazin-3-one
Description:
7-Fluoro-2,5-dihydro-3H-indeno[1,2-c]pyridazin-3-one is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both indene and pyridazine moieties. The presence of a fluorine atom at the 7-position contributes to its chemical reactivity and potential biological activity. This compound typically exhibits a range of properties, including moderate solubility in organic solvents and stability under standard laboratory conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridazinone functional group, which is often associated with various biological activities. The compound may also display interesting electronic properties due to the conjugated system formed by the indeno and pyridazine rings. As with many heterocycles, its reactivity can be influenced by the substituents on the rings, making it a candidate for further chemical modifications to enhance its efficacy or selectivity in biological applications.
Formula:C11H7FN2O
InChI:InChI=1/C11H7FN2O/c12-8-1-2-9-6(4-8)3-7-5-10(15)13-14-11(7)9/h1-2,4-5H,3H2,(H,13,15)
SMILES:c1cc2c(Cc3cc(nnc23)O)cc1F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.