CAS 812-72-6

Allyl-1H,1H-Pentadecafluoro Octyl Ether

Description:

Allyl-1H,1H-Pentadecafluoro Octyl Ether, with the CAS number 812-72-6, is a fluorinated ether characterized by its unique structure that includes a long perfluorinated carbon chain and an allyl group. This compound typically exhibits low surface tension and high thermal stability, making it suitable for various applications, including as a surfactant or in specialty coatings. Its fluorinated nature imparts hydrophobic and oleophobic properties, which can enhance water and oil repellency in formulations. Additionally, it is generally resistant to chemical degradation, contributing to its longevity in various environments. The presence of the allyl group may also allow for further chemical modifications, enabling its use in polymerization processes or as a reactive intermediate in organic synthesis. However, due to the environmental concerns associated with fluorinated compounds, its use may be subject to regulatory scrutiny. Overall, Allyl-1H,1H-Pentadecafluoro Octyl Ether is notable for its unique combination of properties derived from both its fluorinated and ether functionalities.

Formula: C₁₁H₇F₁₅O

InChI: InChI=1/C11H7F15O/c1-2-3-27-4-5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)26/h2H,1,3-4H2

SMILES: C=CCOCC(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

Synonyms:

• Allylpentadecafluorooctylether
• 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-Pentadecafluoro-8-(Prop-2-En-1-Yloxy)Octane