CAS 81201-86-7
:L-phenylalanine-carboxy-13C
Description:
L-phenylalanine-carboxy-13C, with the CAS number 81201-86-7, is a stable isotope-labeled form of the amino acid L-phenylalanine, which is an essential amino acid important for protein synthesis and various metabolic processes. The "carboxy-13C" designation indicates that one of the carbon atoms in the carboxyl group of the phenylalanine molecule is replaced with the carbon-13 isotope, allowing for applications in metabolic studies and tracer experiments. This compound retains the characteristic properties of L-phenylalanine, including its role as a precursor for neurotransmitters such as dopamine, norepinephrine, and epinephrine. It is typically used in research settings, particularly in studies involving protein metabolism, amino acid transport, and the synthesis of phenylalanine-derived compounds. As with other amino acids, it is soluble in water and exhibits a zwitterionic form at physiological pH. The incorporation of the stable isotope allows for advanced analytical techniques, such as nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry, to track metabolic pathways and interactions in biological systems.
Formula:C813CH11NO2
InChI:InChI=1/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i9+1
Synonyms:- L-(13C)phenylalanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
L-Phenylalanine-carboxy-13C
CAS:Controlled ProductFormula:CC8H11NO2Color and Shape:NeatMolecular weight:166.182
