CAS 81216-93-5
:2-(5-bromothiophen-2-yl)quinoline
Description:
2-(5-Bromothiophen-2-yl)quinoline is an organic compound characterized by its unique structure, which combines a quinoline moiety with a bromothiophene substituent. The presence of the bromine atom enhances its reactivity and can influence its electronic properties, making it potentially useful in various applications, including organic electronics and pharmaceuticals. This compound typically exhibits a solid state at room temperature and may have specific solubility characteristics depending on the solvent used, often being soluble in organic solvents. Its molecular structure contributes to its potential as a ligand in coordination chemistry or as an intermediate in organic synthesis. Additionally, the thiophene ring can impart interesting optical and electronic properties, making it a candidate for studies in materials science. The compound's reactivity can be influenced by the bromine substituent, which may participate in electrophilic aromatic substitution reactions. Overall, 2-(5-bromothiophen-2-yl)quinoline is a versatile compound with potential applications in various fields of chemistry.
Formula:C13H8BrNS
InChI:InChI=1/C13H8BrNS/c14-13-8-7-12(16-13)11-6-5-9-3-1-2-4-10(9)15-11/h1-8H
SMILES:c1ccc2c(c1)ccc(c1ccc(Br)s1)n2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

