CymitQuimica logo

CAS 81226-68-8

:

5-bromo-2-chloro-benzenesulfonyl chloride

Description:
5-Bromo-2-chloro-benzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides. This compound features a benzene ring substituted with both bromine and chlorine atoms, contributing to its unique chemical properties. The presence of these halogens can influence the compound's reactivity, making it useful in synthetic organic chemistry, especially in the preparation of more complex molecules. It is typically a solid at room temperature and may exhibit moderate to high toxicity, necessitating careful handling and storage. The compound is soluble in organic solvents, which facilitates its use in various chemical reactions. Additionally, due to its sulfonyl chloride group, it can act as a chlorinating agent, allowing for the introduction of sulfonyl groups into other organic molecules. As with many sulfonyl chlorides, it may release hydrochloric acid upon hydrolysis, which is an important consideration in its handling and application.
Formula:C6H3BrCl2O2S
InChI:InChI=1/C6H3BrCl2O2S/c7-4-1-2-5(8)6(3-4)12(9,10)11/h1-3H
InChI key:QWVGJTXXYAIKIB-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Br)S(=O)(=O)Cl)Cl
Synonyms:
  • 5-Bromo-2-chlorobenzenesulfonyl chloride
  • Benzenesulfonyl chloride, 5-bromo-2-chloro-
  • 5-bromo-2-chlorobenzene-1-sulfonyl chloride
Found 4 products.