CAS 81228-04-8

2-[2-(4-Fluorophenyl)ethoxy]acetic acid

Description:

2-[2-(4-Fluorophenyl)ethoxy]acetic acid, identified by its CAS number 81228-04-8, is an organic compound characterized by its unique structure, which includes a fluorinated aromatic ring and an acetic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, such as moderate solubility in polar solvents due to the presence of the carboxylic acid group. The fluorine atom on the phenyl ring can influence the compound's reactivity and biological activity, often enhancing lipophilicity and altering pharmacokinetic properties. The ethoxy group contributes to the overall hydrophobic character of the molecule, which may affect its interaction with biological systems. As a result, compounds like this one are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure and purity.

Formula: C₁₀H₁₁FO₃

InChI: InChI=1S/C10H11FO3/c11-9-3-1-8(2-4-9)5-6-14-7-10(12)13/h1-4H,5-7H2,(H,12,13)

InChI key: InChIKey=RDTPUXZNQMXLSY-UHFFFAOYSA-N

SMILES: C(COCC(O)=O)C1=CC=C(F)C=C1

Synonyms:

• [[2-(4-Fluorophenyl)ethyl]oxy]acetic acid
• [2-(4-Fluorophenyl)ethoxy]acetic acid
• Acetic acid, [2-(4-fluorophenyl)ethoxy]-
• 2-[2-(4-Fluorophenyl)ethoxy]acetic acid
• Acetic acid, 2-[2-(4-fluorophenyl)ethoxy]-