CAS 81228-09-3: 2,4-Difluorophenylacetic acid
Description:2,4-Difluorophenylacetic acid is an organic compound characterized by its aromatic structure and the presence of two fluorine atoms on the phenyl ring. It features a carboxylic acid functional group, which contributes to its acidic properties. The compound is typically a white to off-white solid at room temperature and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid group. Its molecular structure allows for potential applications in pharmaceuticals and agrochemicals, particularly as a herbicide or plant growth regulator. The presence of fluorine atoms can enhance the compound's biological activity and stability. Additionally, 2,4-difluorophenylacetic acid may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, its unique properties stem from the combination of the difluorophenyl group and the acetic acid moiety, making it a compound of interest in various chemical research fields.
Formula:C8H6F2O2
InChI:InChI=1S/C8H6F2O2/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4H,3H2,(H,11,12)
InChI key:InChIKey=QPKZIGHNRLZBCL-UHFFFAOYSA-N
SMILES:O=C(O)CC1=CC=C(F)C=C1F
- Synonyms:
- (2,4-Difluorophenyl)Acetate
- 1,8-Dibromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane
- 2,4-Difluorobenzeneacetic acid
- 2,4-difluoro-Benzeneacetic acid
- 2-(2,4-Difluorophenyl)acetic acid
- Benzeneacetic acid, 2,4-difluoro-
- Octane, 1,8-dibromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-
- 2,4-Difluorophenylacetic acid
