
CAS 81259-54-3
:Benzaldehyde, 3-methoxy-4-(phenylmethoxy)-, oxime
Description:
Benzaldehyde, 3-methoxy-4-(phenylmethoxy)-, oxime, with the CAS number 81259-54-3, is an organic compound characterized by its oxime functional group, which is derived from the reaction of benzaldehyde with hydroxylamine. This compound features a benzaldehyde moiety substituted with a methoxy group and a phenylmethoxy group, contributing to its unique chemical properties. It typically appears as a colorless to pale yellow liquid and is soluble in organic solvents. The presence of the oxime functional group imparts specific reactivity, allowing it to participate in various chemical reactions, such as condensation and rearrangement. Additionally, the methoxy and phenylmethoxy substituents can influence the compound's polarity and reactivity, making it of interest in synthetic organic chemistry and potentially in the development of pharmaceuticals or agrochemicals. Its stability and reactivity under different conditions can vary, making it essential to consider the specific environment when handling or utilizing this compound in laboratory or industrial settings.
Formula:C15H15NO3
InChI:InChI=1S/C15H15NO3/c1-18-15-9-13(10-16-17)7-8-14(15)19-11-12-5-3-2-4-6-12/h2-10,17H,11H2,1H3
InChI key:InChIKey=PPLVIICZBZGSPO-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(OC)C=C(C=NO)C=C2
Synonyms:- Benzaldehyde, 3-methoxy-4-(phenylmethoxy)-, oxime
- 3-Methoxy-4-(phenylmethoxy)benzaldehyde oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.