CAS 81261-83-8

3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol

Description:

3-[(4,6-Dimethylpyrimidin-2-yl)amino]phenol, with the CAS number 81261-83-8, is an organic compound characterized by its aromatic structure, which includes a phenolic group and a pyrimidine moiety. This compound features a 4,6-dimethylpyrimidine ring substituted with an amino group that is linked to a phenolic hydroxyl group. The presence of both the amino and hydroxyl functional groups contributes to its potential as a ligand in coordination chemistry and its utility in various biological applications, such as acting as a pharmaceutical intermediate or a potential drug candidate. The compound is likely to exhibit moderate solubility in polar solvents due to the hydroxyl group, while the pyrimidine ring may impart some degree of basicity. Its molecular structure suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Overall, this compound's unique structural features make it of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₂H₁₃N₃O

InChI: InChI=1/C12H13N3O/c1-8-6-9(2)14-12(13-8)15-10-4-3-5-11(16)7-10/h3-7,16H,1-2H3,(H,13,14,15)

SMILES: Cc1cc(C)nc(n1)Nc1cccc(c1)O

Synonyms:

• Phenol, 3-[(4,6-Dimethyl-2-Pyrimidinyl)Amino]-

3-[(4,6-dimethyl-2-pyrimidinyl)amino]phenol

CAS: 81261-83-8

Formula: C₁₂H₁₃N₃O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 215.256

Ref: 10-F315592