
CAS 81262-69-3
:N,α,α-Trimethyl-1,3-benzodioxole-5-ethanamine
Description:
N,α,α-Trimethyl-1,3-benzodioxole-5-ethanamine, identified by its CAS number 81262-69-3, is a chemical compound that belongs to the class of substituted phenethylamines. It features a benzodioxole structure, which is characterized by a fused dioxole ring system attached to a benzene ring, contributing to its unique chemical properties. The presence of the trimethyl group and the ethanamine moiety indicates that this compound has potential for various interactions due to its amine functional group, which can participate in hydrogen bonding and other chemical reactions. This compound may exhibit psychoactive properties, similar to other phenethylamines, and is of interest in both medicinal chemistry and pharmacology. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many compounds in this class, safety and regulatory considerations are important, particularly regarding its potential use in research or therapeutic applications.
Formula:C12H17NO2
InChI:InChI=1S/C12H17NO2/c1-12(2,13-3)7-9-4-5-10-11(6-9)15-8-14-10/h4-6,13H,7-8H2,1-3H3
InChI key:InChIKey=CRFWCCGPRXKZSM-UHFFFAOYSA-N
SMILES:C(C(NC)(C)C)C=1C=C2C(=CC1)OCO2
Synonyms:- [1-(2H-1,3-Benzodioxol-5-yl)-2-methylpropan-2-yl](methyl)amine
- N,α,α-Trimethyl-1,3-benzodioxole-5-ethanamine
- 1,3-Benzodioxole-5-ethanamine, N,α,α-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.