CAS 81263-97-0
:Kaur-16-en-18-oic acid, 6,11-dihydroxy-15-oxo-, β-D-glucopyranosyl ester, (4α,6β,11β)-
Description:
Kaur-16-en-18-oic acid, 6,11-dihydroxy-15-oxo-, β-D-glucopyranosyl ester, with the CAS number 81263-97-0, is a complex organic compound belonging to the class of terpenoids, specifically a type of kaurene. This compound features a steroid-like structure characterized by a fused ring system and multiple functional groups, including hydroxyl (-OH) and carbonyl (C=O) groups, which contribute to its reactivity and potential biological activity. The presence of the β-D-glucopyranosyl ester indicates that it is glycosylated, which can enhance its solubility and bioavailability in biological systems. Kaur-16-en-18-oic acid derivatives are often studied for their pharmacological properties, including anti-inflammatory and anticancer activities. The stereochemistry, denoted by the specific configuration at various carbon centers, plays a crucial role in determining the compound's interactions with biological targets. Overall, this compound exemplifies the intricate relationship between structure and function in natural products, particularly in the context of medicinal chemistry and phytochemistry.
Formula:C26H38O10
InChI:InChI=1S/C26H38O10/c1-11-12-7-13(28)20-24(2)5-4-6-25(3,19(24)14(29)9-26(20,8-12)21(11)33)23(34)36-22-18(32)17(31)16(30)15(10-27)35-22/h12-20,22,27-32H,1,4-10H2,2-3H3/t12-,13+,14-,15-,16-,17+,18-,19+,20+,22+,24-,25-,26+/m1/s1
InChI key:InChIKey=OIMCIPSRGXJJFP-OHHFPUJUSA-N
SMILES:C[C@]12[C@]3([C@]4(C[C@@](C[C@@H]3O)(C(=C)C4=O)[H])C[C@@H](O)[C@@]1([C@@](C(O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)=O)(C)CCC2)[H])[H]
Synonyms:- Kaur-16-en-18-oic acid, 6,11-dihydroxy-15-oxo-, β-D-glucopyranosyl ester, (4α,6β,11β)-
- 1H-2,10a-Ethanophenanthrene, kaur-16-en-18-oic acid deriv.
- ent-6,11-Dihydroxy-15-oxo-16-kauren-19-oic acid beta-D-glucopyranosyl ester
- ent-6,11-Dihydroxy-15-oxokaur-16-en
- -19-oic acid β-D-glucopyranosyl ester
- -19-oic acid beta-D-glucopyrasyl ester
- 6beta-Hydroxypaniculoside III
- ENT-6,11-DIHYDROXY-15-OXOKAUR-16
- ent-6,11-Dihydroxy-15-oxo-16-kauren
- Kaur-16-en-18-oic acid, 6,11-dihydroxy-15-oxo-, β-D-glucopyranosyl ester, (4α,6β,11β)- (9CI)
- ent-6,11-Dihydroxy-15-oxokaur-16-en-19-oic acid β-D-glucopyranosyl ester
- 6β-HydroxypaniculosideIII
- 6β-Hydroxypaniculoside III
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
ent-6,11-Dihydroxy-15-oxo-16-kauren -19-oic acid β-D-glucopyrasyl ester
CAS:Formula:C26H38O10Purity:96.5%Molecular weight:510.5739ent-6,11-Dihydroxy-15-oxo-16-kauren-19-oic acid β-D-glucopyranosyl ester
CAS:ent-6,11-Dihydroxy-15-oxo-16-kauren-19-oic acid beta-D-glucopyranosyl ester is a natural product for research related to life sciences.Formula:C26H38O10Purity:98%Color and Shape:SolidMolecular weight:510.586β-Hydroxypaniculoside III
CAS:Formula:C26H38O10Purity:95%~99%Color and Shape:Cryst.Molecular weight:510.58Ent-6,11-dihydroxy-15-oxo-16-kauren-19-oic acid beta-D-glucopyranosyl ester
CAS:<p>Ent-6,11-dihydroxy-15-oxo-16-kauren-19-oic acid beta-D-glucopyranosyl ester is a natural chemical compound classified as a glucoside. It is derived from the kaurene class of diterpenoids, typically found in certain plant species known for their medicinal properties. This compound exhibits potential pharmacological activities due to its unique structure, which combines a kaurene skeleton with a glucoside moiety.</p>Formula:C26H38O10Purity:Min. 95%Molecular weight:510.6 g/mol



