CAS 812642-63-0
:3-iodo-4-(prop-2-yn-1-yloxy)benzaldehyde
Description:
3-Iodo-4-(prop-2-yn-1-yloxy)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and an ether linkage. The presence of the iodine atom at the 3-position of the benzene ring enhances its reactivity, making it a useful intermediate in various chemical syntheses. The prop-2-yn-1-yloxy group introduces an alkyne functionality, which can participate in further reactions such as coupling or cycloaddition. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for potential applications in medicinal chemistry, particularly in the development of new pharmaceuticals or agrochemicals. Additionally, the presence of both the aldehyde and alkyne functionalities provides opportunities for diverse chemical transformations, including nucleophilic additions and cross-coupling reactions. Safety precautions should be observed when handling this compound, as iodine-containing compounds can be hazardous.
Formula:C10H7IO2
InChI:InChI=1/C10H7IO2/c1-2-5-13-10-4-3-8(7-12)6-9(10)11/h1,3-4,6-7H,5H2
SMILES:C#CCOc1ccc(cc1I)C=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
