CAS 812642-68-5

2-(4-Formyl-2,6-dimethoxyphenoxy)propanoic acid

Description:

2-(4-Formyl-2,6-dimethoxyphenoxy)propanoic acid, with the CAS number 812642-68-5, is an organic compound characterized by its unique functional groups and structural features. It contains a propanoic acid moiety, which contributes to its acidic properties, and a phenoxy group that is substituted with a formyl group and two methoxy groups on the aromatic ring. This compound is likely to exhibit both hydrophilic and lipophilic characteristics due to the presence of polar functional groups and a hydrophobic aromatic system. The formyl group suggests potential reactivity in condensation reactions, while the methoxy groups can influence the compound's electronic properties and steric hindrance. Additionally, the presence of the carboxylic acid group indicates that it can participate in acid-base reactions. Overall, this compound may have applications in organic synthesis, pharmaceuticals, or as a biochemical probe, although specific applications would depend on further research into its reactivity and biological activity.

Formula: C₁₂H₁₄O₆

InChI: InChI=1S/C12H14O6/c1-7(12(14)15)18-11-9(16-2)4-8(6-13)5-10(11)17-3/h4-7H,1-3H3,(H,14,15)

InChI key: InChIKey=ZZTPVGFRGWPXEF-UHFFFAOYSA-N

SMILES: O(C(C(O)=O)C)C1=C(OC)C=C(C=O)C=C1OC

Synonyms:

• 2-(4-Formyl-2,6-dimethoxyphenoxy)propanoic acid
• Propanoic acid, 2-(4-formyl-2,6-dimethoxyphenoxy)-