CAS 812642-70-9

2-[4-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)phenoxy]propanoic acid

Description:

2-[4-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)phenoxy]propanoic acid, with the CAS number 812642-70-9, is a chemical compound characterized by its complex structure that includes a pyrrole ring and a phenoxy group. This compound features a propanoic acid moiety, which contributes to its acidic properties. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation or oxidation. The dimethyl substitution on the pyrrole ring enhances its stability and may influence its reactivity and solubility in organic solvents. This compound is likely to exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific interactions and applications would depend on further studies, including its pharmacokinetics and mechanism of action. Overall, the unique structural features of this compound suggest potential utility in various chemical and biological contexts.

Formula: C₁₆H₁₇NO₄

InChI: InChI=1S/C16H17NO4/c1-10-8-13(9-18)11(2)17(10)14-4-6-15(7-5-14)21-12(3)16(19)20/h4-9,12H,1-3H3,(H,19,20)

InChI key: InChIKey=NNWLCURZXVIPEC-UHFFFAOYSA-N

SMILES: Cc1cc(C=O)c(C)n1c1ccc(cc1)OC(C)C(=O)O

Synonyms:

• propanoic acid, 2-[4-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)phenoxy]-