CAS 812642-72-1
:2-(2-ethoxy-4-formyl-6-nitrophenoxy)propanoic acid
Description:
2-(2-Ethoxy-4-formyl-6-nitrophenoxy)propanoic acid, identified by its CAS number 812642-72-1, is a chemical compound that features a complex structure characterized by the presence of a propanoic acid moiety linked to a phenoxy group. The compound contains an ethoxy group and a nitro substituent, which contribute to its chemical reactivity and potential biological activity. The formyl group indicates the presence of an aldehyde functional group, which can participate in various chemical reactions, such as condensation and reduction. This compound may exhibit properties typical of both aromatic and aliphatic compounds, including solubility in organic solvents and potential interactions with biological systems. Its unique structure suggests possible applications in pharmaceuticals or agrochemicals, although specific biological activities or uses would require further investigation. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the nitro group, which can impart explosive properties under certain conditions.
Formula:C12H13NO7
InChI:InChI=1/C12H13NO7/c1-3-19-10-5-8(6-14)4-9(13(17)18)11(10)20-7(2)12(15)16/h4-7H,3H2,1-2H3,(H,15,16)
SMILES:CCOc1cc(cc(c1OC(C)C(=O)O)N(=O)=O)C=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
