CAS 812642-73-2

(4-formyl-2,6-dimethoxyphenoxy)acetic acid

Description:

(4-formyl-2,6-dimethoxyphenoxy)acetic acid, identified by its CAS number 812642-73-2, is an organic compound characterized by its phenolic structure and the presence of both formyl and acetic acid functional groups. This compound features a methoxy substitution at the 2 and 6 positions of the phenyl ring, which can influence its reactivity and solubility. The formyl group contributes to its potential as an aldehyde, making it reactive in various chemical reactions, such as condensation and oxidation. The acetic acid moiety provides acidic properties, allowing for potential interactions with bases and other nucleophiles. This compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its solubility is likely influenced by the methoxy groups, which can enhance its compatibility with organic solvents. Overall, (4-formyl-2,6-dimethoxyphenoxy)acetic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₁H₁₂O₆

InChI: InChI=1/C11H12O6/c1-15-8-3-7(5-12)4-9(16-2)11(8)17-6-10(13)14/h3-5H,6H2,1-2H3,(H,13,14)

SMILES: COc1cc(cc(c1OCC(=O)O)OC)C=O