CymitQuimica logo

CAS 81265-87-4

:

2-(3-fluorophenyl)-2H-indazole

Description:
2-(3-Fluorophenyl)-2H-indazole, with the CAS number 81265-87-4, is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluorophenyl group at the 2-position of the indazole contributes to its unique properties, including potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests it could participate in various chemical reactions, including electrophilic substitutions due to the electron-withdrawing nature of the fluorine atom. Additionally, the compound may possess interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, 2-(3-fluorophenyl)-2H-indazole represents a versatile compound with potential applications in research and development.
Formula:C13H9FN2
InChI:InChI=1/C13H9FN2/c14-11-5-3-6-12(8-11)16-9-10-4-1-2-7-13(10)15-16/h1-9H
SMILES:c1ccc2c(c1)cn(c1cccc(c1)F)n2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.