CAS 81267-65-4
:Phenoxodiol
Description:
Phenoxodiol, with the CAS number 81267-65-4, is a synthetic compound that belongs to the class of phenolic compounds. It is primarily recognized for its potential therapeutic applications, particularly in oncology, where it has been investigated for its ability to induce apoptosis in cancer cells and enhance the efficacy of certain chemotherapeutic agents. Phenoxodiol exhibits a unique mechanism of action by modulating various signaling pathways involved in cell survival and death. The compound is characterized by its solubility in organic solvents and limited water solubility, which influences its bioavailability and pharmacokinetics. Additionally, it has been studied for its anti-inflammatory properties and potential use in treating other conditions beyond cancer. Safety and toxicity profiles are essential considerations in its development, as with any pharmaceutical agent. Overall, Phenoxodiol represents a promising candidate in the field of cancer treatment, although further research is necessary to fully understand its efficacy and safety in clinical settings.
Formula:C15H12O3
InChI:InChI=1S/C15H12O3/c16-13-4-1-10(2-5-13)12-7-11-3-6-14(17)8-15(11)18-9-12/h1-8,16-17H,9H2
InChI key:InChIKey=ZZUBHVMHNVYXRR-UHFFFAOYSA-N
SMILES:OC=1C=C2C(C=C(CO2)C3=CC=C(O)C=C3)=CC1
Synonyms:- 2H-1-Benzopyran-7-ol, 3-(4-hydroxyphenyl)-
- 3-(4-Hydroxyphenyl)-2H-1-benzopyran-7-ol
- 3-(4-Hydroxyphenyl)-2H-benzopyran-7-ol
- 3-(4-hydroxyphenyl)-2H-chromen-7-ol
- D 7446
- Dehydroequol
- Haginin E
- Idronoxil
- Nv 06
- Phenoxodiol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Dehydroequol
CAS:Formula:C15H12O3Purity:≥ 97% (1H-NMR)Color and Shape:White to off-white powder or solidMolecular weight:240.25Phenoxodiol
CAS:Phenoxodiol (Idronoxil) activates the mitochondrial caspase system, inhibits X-linked inhibitor of apoptosis(XIAP), disrupts FLICE inhibitory protein(FLIP)Formula:C15H12O3Purity:98.07% - 99.18%Color and Shape:SolidMolecular weight:240.25Ref: TM-T16522
1mg63.00€5mg137.00€10mg215.00€25mg353.00€50mg537.00€100mg767.00€1mL*10mM (DMSO)150.00€Dehydroequol
CAS:Dehydroequol is a dietary supplement ingredient, which is a metabolite of the soy isoflavone daidzein. It is produced through the biotransformation by certain gut bacteria that convert daidzein into equol compounds, specifically the dehydrogenated form. This compound is noted for its estrogenic activity, acting primarily as a selective estrogen receptor modulator (SERM). Dehydroequol binds to estrogen receptors with a preference for the beta subtype, exerting moderate estrogenic effects.
Formula:C15H12O3Purity:Min. 95%Molecular weight:240.25 g/mol





