CAS 81280-12-8
:4-Methyl-4-hepten-3-ol
Description:
4-Methyl-4-hepten-3-ol, with the CAS number 81280-12-8, is an organic compound classified as an alcohol due to the presence of a hydroxyl (-OH) functional group. It features a branched carbon chain, specifically a heptene backbone with a methyl group at the fourth carbon and a double bond between the fourth and fifth carbons. This structure contributes to its unique properties, including its potential as a flavoring agent or fragrance due to its pleasant odor. The compound is typically a colorless liquid at room temperature and is soluble in organic solvents. Its reactivity is influenced by the presence of the double bond, which can participate in various chemical reactions, such as addition reactions. Additionally, like many alcohols, it may exhibit moderate volatility and can be flammable. Safety data should be consulted for handling and storage, as it may pose health risks if ingested or inhaled. Overall, 4-Methyl-4-hepten-3-ol is of interest in both industrial applications and research contexts.
Formula:C8H16O
InChI:InChI=1/C8H16O/c1-4-6-7(3)8(9)5-2/h6,8-9H,4-5H2,1-3H3/b7-6+/t8-/m1/s1
Synonyms:- (4E)-4-methylhept-4-en-3-ol
- (3R,4E)-4-methylhept-4-en-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

