CAS 813-58-1
:2,2-Diethylbutanoic acid
Description:
2,2-Diethylbutanoic acid, with the CAS number 813-58-1, is a branched-chain carboxylic acid characterized by its unique structure, which includes two ethyl groups attached to the second carbon of a butanoic acid backbone. This compound typically appears as a colorless to pale yellow liquid and has a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic ethyl groups. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and neutralization. 2,2-Diethylbutanoic acid can be used in organic synthesis and may serve as an intermediate in the production of other chemical compounds. Its physical and chemical properties, such as boiling point and melting point, are influenced by its molecular structure and the presence of functional groups. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H16O2
InChI:InChI=1S/C8H16O2/c1-4-8(5-2,6-3)7(9)10/h4-6H2,1-3H3,(H,9,10)
InChI key:InChIKey=GHXNRYVDXNZXID-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CC)(CC)CC
Synonyms:- Triethylacetic acid
- Butanoic acid, 2,2-diethyl-
- Acetic acid, triethyl-
- Butyric acid, 2,2-diethyl-
- 2,2-Diethylbutanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,2-Diethylbutanoic acid
CAS:2,2-Diethylbutanoic acid is a fluorescent probe that can be used to detect messenger RNA (mRNA). It is believed that 2,2-diethylbutanoic acid binds to the dinucleotide phosphate and inhibits the synthesis of proteins. This compound has been shown to inhibit tumor growth in mice by binding to the carboxylate and hydroxyl groups of the cell membrane. 2,2-Diethylbutanoic acid has also been used as an analog for clopidogrel, which is a drug that inhibits platelet aggregation.Formula:C8H16O2Purity:Min. 95%Molecular weight:144.21 g/mol
