CAS 81303-69-7

amino(cyclopentyl)methaniminium chloride

Description:

Amino(cyclopentyl)methaniminium chloride, with the CAS number 81303-69-7, is a quaternary ammonium compound characterized by its unique structure that includes a cyclopentyl group attached to a methaniminium moiety. This compound typically exhibits properties associated with ionic compounds, such as high solubility in polar solvents like water due to the presence of the chloride ion. The amino group contributes to its basicity and potential reactivity, making it useful in various chemical applications, including as a reagent in organic synthesis or as a potential intermediate in the production of pharmaceuticals. The cyclopentyl group may impart specific steric and electronic properties, influencing the compound's behavior in biological systems or chemical reactions. Additionally, the presence of the chloride ion suggests that it may participate in ionic interactions, which can affect its stability and reactivity. Overall, amino(cyclopentyl)methaniminium chloride is a compound of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₆H₁₃ClN₂

InChI: InChI=1/C6H12N2.ClH/c7-6(8)5-3-1-2-4-5;/h5H,1-4H2,(H3,7,8);1H

SMILES: C1CCC(C1)C(=N)N.Cl

Synonyms:

• Cyclopentanecarboximidamide hydrochloride (1:1)