
CAS 81307-24-6
:(11aS)-1,2,3,11a-Tetrahydro-8-hydroxy-7-methoxy-5H-pyrrolo[2,1-c][1,4]benzodiazepin-5-one
Description:
The chemical substance known as (11aS)-1,2,3,11a-Tetrahydro-8-hydroxy-7-methoxy-5H-pyrrolo[2,1-c][1,4]benzodiazepin-5-one, with the CAS number 81307-24-6, is a member of the benzodiazepine class of compounds, which are characterized by their bicyclic structure containing a benzene ring fused to a diazepine ring. This specific compound features a tetrahydro-pyrrolo structure, indicating it has undergone partial hydrogenation, which contributes to its unique pharmacological properties. The presence of hydroxy and methoxy functional groups suggests potential for hydrogen bonding and increased lipophilicity, which can influence its solubility and bioavailability. Such compounds are often investigated for their potential therapeutic effects, including anxiolytic, sedative, or anticonvulsant activities. The stereochemistry indicated by the (11aS) designation suggests specific spatial arrangements of atoms that can significantly affect the compound's biological activity and interaction with receptors. Overall, this compound represents a complex structure with potential implications in medicinal chemistry and pharmacology.
Formula:C13H14N2O3
InChI:InChI=1S/C13H14N2O3/c1-18-12-5-9-10(6-11(12)16)14-7-8-3-2-4-15(8)13(9)17/h5-8,16H,2-4H2,1H3/t8-/m0/s1
InChI key:InChIKey=LQDGLTOVYOUCRG-QMMMGPOBSA-N
SMILES:O=C1C=2C(=CC(O)=C(OC)C2)N=C[C@]3(N1CCC3)[H]
Synonyms:- Antibiotic DC 81
- 5H-Pyrrolo[2,1-c][1,4]benzodiazepin-5-one, 1,2,3,11a-tetrahydro-8-hydroxy-7-methoxy-, (11aS)-
- DC 81
- (11aS)-1,2,3,11a-Tetrahydro-8-hydroxy-7-methoxy-5H-pyrrolo[2,1-c][1,4]benzodiazepin-5-one
- 5H-Pyrrolo[2,1-c][1,4]benzodiazepin-5-one, 1,2,3,11a-tetrahydro-8-hydroxy-7-methoxy-, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Antibiotic DC 81
CAS:DC 81: Streptomyces-derived antitumor antibiotic, potent nucleic acid synthesis inhibitor, binds DNA sequences, forms covalent adducts.Formula:C13H14N2O3Color and Shape:SolidMolecular weight:246.26
