
CAS 81316-84-9
:1-Nitrocoronene
Description:
1-Nitrocoronene is a polycyclic aromatic compound characterized by its structure, which consists of a coronene core with a nitro group (-NO2) substituent. This compound is notable for its potential applications in materials science, particularly in organic electronics and as a precursor for various chemical syntheses. The presence of the nitro group can influence its electronic properties, making it a subject of interest in the study of charge transport and photophysical behavior. 1-Nitrocoronene is typically insoluble in water but may dissolve in organic solvents, which is common for many polycyclic aromatic hydrocarbons. Its stability and reactivity can vary depending on environmental conditions, such as temperature and the presence of other chemicals. Additionally, the compound's aromatic nature contributes to its potential as a building block in the design of advanced materials, including sensors and light-emitting devices. Safety data should be consulted for handling and exposure risks, as nitro compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C24H11NO2
InChI:InChI=1S/C24H11NO2/c26-25(27)18-11-16-8-7-14-4-2-12-1-3-13-5-6-15-9-10-17(18)24-22(15)20(13)19(12)21(14)23(16)24/h1-11H
InChI key:InChIKey=MIKASNJPHHKWQC-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C3=C4C=5C=6C=7C3=C(C=C2)C=CC7C=CC6C=CC5C=CC4=C1
Synonyms:- Coronene, 1-nitro-
- Coronene, nitro-
- 1-Nitrocoronene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.