CAS 81321-37-1

ethyl (2E)-chloro[(3-chloro-4-fluorophenyl)hydrazono]ethanoate

Description:

Ethyl (2E)-chloro[(3-chloro-4-fluorophenyl)hydrazono]ethanoate, with the CAS number 81321-37-1, is a chemical compound characterized by its unique structural features, including an ethyl ester functional group and a hydrazone linkage. This compound typically exhibits a moderate level of polarity due to the presence of both hydrophilic (ethyl ester) and hydrophobic (aromatic) components. The chloro and fluoro substituents on the phenyl ring contribute to its reactivity and potential biological activity, making it of interest in medicinal chemistry. The hydrazone functional group can participate in various chemical reactions, including condensation and reduction, which may be relevant in synthetic applications. Additionally, the compound's molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of compounds with specific biological activities. Its stability and solubility characteristics would depend on the solvent system and environmental conditions, which are crucial for its practical applications in research and industry.

Formula: C₁₀H₉Cl₂FN₂O₂

InChI: InChI=1/C10H9Cl2FN2O2/c1-2-17-10(16)9(12)15-14-6-3-4-8(13)7(11)5-6/h3-5,14H,2H2,1H3/b15-9+

Synonyms:

• Acetic acid, 2-chloro-2-[2-(3-chloro-4-fluorophenyl)hydrazinylidene]-, ethyl ester, (2E)-
• Ethyl (2E)-chloro[(3-chloro-4-fluorophenyl)hydrazono]acetate