CAS 81340-56-9
:3-(3-iodophenyl)-3-(trifluoromethyl)-3H-diazirene
Description:
3-(3-Iodophenyl)-3-(trifluoromethyl)-3H-diazirene, with the CAS number 81340-56-9, is a diazirene compound characterized by its unique structure, which includes a diazirene ring and substituents that significantly influence its chemical properties. The presence of the trifluoromethyl group contributes to its electron-withdrawing characteristics, enhancing its reactivity, particularly in photochemical reactions. The 3-iodophenyl group adds to the compound's stability and can facilitate various substitution reactions. Diazirenes are known for their ability to undergo thermal or photochemical decomposition, leading to the formation of reactive intermediates, such as carbenes, which can participate in further chemical transformations. This compound is typically used in synthetic organic chemistry, particularly in the development of new materials and in the study of reaction mechanisms. Its unique properties make it a valuable tool in research, especially in the fields of photochemistry and materials science. However, handling precautions are necessary due to the potential reactivity and toxicity associated with halogenated compounds.
Formula:C8H4F3IN2
InChI:InChI=1/C8H4F3IN2/c9-8(10,11)7(13-14-7)5-2-1-3-6(12)4-5/h1-4H
SMILES:c1cc(cc(c1)I)C1(C(F)(F)F)N=N1
Synonyms:- 3H-diazirine, 3-(3-iodophenyl)-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.