CAS 813412-37-2
:9H-fluoren-9-ylmethyl 3-aminopyrrolidine-1-carboxylate
Description:
9H-fluoren-9-ylmethyl 3-aminopyrrolidine-1-carboxylate, with the CAS number 813412-37-2, is a chemical compound characterized by its unique structure, which includes a fluorenylmethyl group and a pyrrolidine ring. This compound typically exhibits properties associated with both amines and carboxylates, making it potentially useful in various chemical reactions and applications. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to the presence of the fluorenyl moiety, which enhances its hydrophobic characteristics. The amino group in the pyrrolidine ring may impart basicity, allowing for interactions with acids and other electrophiles. Additionally, the carboxylate functionality can participate in hydrogen bonding and may influence the compound's reactivity and stability. This compound may find applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C19H20N2O2
InChI:InChI=1/C19H20N2O2/c20-13-9-10-21(11-13)19(22)23-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,13,18H,9-12,20H2
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=O)N1CCC(C1)N
Synonyms:- 1-pyrrolidinecarboxylic acid, 3-amino-, 9H-fluoren-9-ylmethyl ester
- 9H-Fluoren-9-ylmethyl-3-aminopyrrolidin-1-carboxylat
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Amino-pyrrolidine-1-carboxylic acid 9h-fluoren-9-ylmethyl ester
CAS:Formula:C19H20N2O2Molecular weight:308.3743
