CAS 813412-40-7
:4,4-Difluoro-1-butanamine
Description:
4,4-Difluoro-1-butanamine is an organic compound characterized by the presence of a butanamine backbone with two fluorine atoms attached to the fourth carbon. Its molecular structure features a primary amine functional group, which contributes to its reactivity and potential applications in various chemical processes. The presence of fluorine atoms enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and agrochemical research. Typically, compounds like 4,4-difluoro-1-butanamine may exhibit properties such as moderate volatility and solubility in polar solvents, depending on the specific functional groups present. Additionally, the compound's reactivity can be influenced by the electronegative fluorine atoms, which can participate in hydrogen bonding and affect the overall stability of the molecule. Safety data sheets would provide essential information regarding its handling, storage, and potential hazards, as with any chemical substance. Overall, 4,4-difluoro-1-butanamine represents a unique structure that may have diverse applications in synthetic chemistry and material science.
Formula:C4H9F2N
InChI:InChI=1S/C4H9F2N/c5-4(6)2-1-3-7/h4H,1-3,7H2
InChI key:InChIKey=UREOFAQFBIQBEZ-UHFFFAOYSA-N
SMILES:C(C(F)F)CCN
Synonyms:- (4,4-Difluorobutyl)amine
- 4,4-Difluoro-1-butanamine
- 1-Butanamine, 4,4-difluoro-
- 4,4-DIFLUOROBUTYLAMINE, HYDROCHLORIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.