CAS 813424-20-3

3-Chloro-N2-methyl-2,5-pyridinediamine

Description:

3-Chloro-N2-methyl-2,5-pyridinediamine, with the CAS number 813424-20-3, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two amino groups (–NH2) and a chlorine substituent at the 3-position of the pyridine ring, along with a methyl group at the N2 position. The presence of these functional groups suggests that it may exhibit properties such as basicity due to the amino groups and potential reactivity due to the chlorine atom. The compound is likely to be soluble in polar solvents, given the presence of the amino groups, which can engage in hydrogen bonding. Its structure may allow it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may have applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological activity and reactivity. Safety data and handling precautions should be consulted due to the presence of chlorine and amine functionalities.

Formula: C₆H₈ClN₃

InChI: InChI=1S/C6H8ClN3/c1-9-6-5(7)2-4(8)3-10-6/h2-3H,8H2,1H3,(H,9,10)

InChI key: InChIKey=BHJNNOVZXUAUBO-UHFFFAOYSA-N

SMILES: N(C)C1=C(Cl)C=C(N)C=N1

Synonyms:

• 2,5-Pyridinediamine, 3-chloro-N2-methyl-
• 3-Chloro-2-N-methylpyridine-2,5-diamine
• 3-Chloro-N2-methyl-2,5-pyridinediamine
• N-Methyl-3-chloropyridine-2,5-diamine