CymitQuimica logo

CAS 813426-13-0

:

1,2,3,5-tetrahydrospiro[1-benzazepine-4,1'-cyclopent[2]ene]-3'-carboxylic acid

Description:
1,2,3,5-Tetrahydrospiro[1-benzazepine-4,1'-cyclopent[2]ene]-3'-carboxylic acid is a complex organic compound characterized by its unique spirocyclic structure, which combines a benzazepine moiety with a cyclopentene ring. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the cyclic structure, contributing to its stability and reactivity. The carboxylic acid functional group (-COOH) present in the molecule imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The presence of multiple rings in its structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the compound's stereochemistry and spatial arrangement can influence its interactions with biological targets, potentially affecting its pharmacological profile. Overall, this compound exemplifies the complexity and diversity of organic molecules, with implications for research in both synthetic and medicinal chemistry.
Formula:C15H17NO2
InChI:InChI=1/C15H17NO2/c17-14(18)12-5-6-15(10-12)7-8-16-13-4-2-1-3-11(13)9-15/h1-4,10,16H,5-9H2,(H,17,18)
SMILES:c1ccc2c(c1)CC1(CCC(=C1)C(=O)O)CCN2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.