CAS 81344-59-4

Methyl α-cyano-3-thiopheneacetate

Description:

Methyl α-cyano-3-thiopheneacetate is an organic compound characterized by its unique structure, which includes a thiophene ring, a cyano group, and an ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the cyano group contributes to its reactivity, making it useful in nucleophilic addition reactions. Additionally, the thiophene moiety can impart interesting electronic properties, which may enhance its utility in materials science, particularly in organic electronics. Methyl α-cyano-3-thiopheneacetate is generally stable under standard conditions but should be handled with care due to its potential toxicity and reactivity. Proper safety measures, including the use of personal protective equipment, are recommended when working with this compound in a laboratory setting.

Formula: C₈H₇NO₂S

InChI: InChI=1S/C8H7NO2S/c1-11-8(10)7(4-9)6-2-3-12-5-6/h2-3,5,7H,1H3

InChI key: InChIKey=VFMUSSCPSVLZSQ-UHFFFAOYSA-N

SMILES: C(C(OC)=O)(C#N)C=1C=CSC1

Synonyms:

• Methyl α-cyano-3-thiopheneacetate
• 3-Thiopheneacetic acid, α-cyano-, methyl ester