
CAS 813449-01-3
:6-Bromo-1-(2-methoxyethyl)-1H-benzimidazole
Description:
6-Bromo-1-(2-methoxyethyl)-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a bromine atom and a 2-methoxyethyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The methoxyethyl group may enhance its solubility in polar solvents and influence its biological activity. Benzimidazole derivatives are known for their diverse pharmacological properties, including antifungal, antiviral, and anticancer activities, making this compound of interest in medicinal chemistry. Additionally, the presence of the bromine atom can affect the compound's electronic properties and steric hindrance, potentially impacting its interaction with biological targets. Overall, 6-Bromo-1-(2-methoxyethyl)-1H-benzimidazole represents a versatile scaffold for further chemical modifications and investigations in drug development.
Formula:C10H11BrN2O
InChI:InChI=1S/C10H11BrN2O/c1-14-5-4-13-7-12-9-3-2-8(11)6-10(9)13/h2-3,6-7H,4-5H2,1H3
InChI key:InChIKey=OIEPDDQMGQZHNP-UHFFFAOYSA-N
SMILES:C(COC)N1C=2C(N=C1)=CC=C(Br)C2
Synonyms:- 6-Bromo-1-(2-methoxyethyl)-1H-benzimidazole
- 1-(2-Methoxyethyl)-6-bromobenzimidazole
- 1H-Benzimidazole, 6-bromo-1-(2-methoxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.