CAS 81346-71-6
:2-[4-(3-amino-2-hydroxy-propoxy)phenyl]acetamide
Description:
2-[4-(3-amino-2-hydroxy-propoxy)phenyl]acetamide, with the CAS number 81346-71-6, is an organic compound characterized by its amide functional group and a phenyl ring substituted with a propoxy chain. This compound features an amino group and a hydroxyl group, which contribute to its potential as a bioactive molecule. The presence of these functional groups suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. Typically, compounds of this nature can be involved in various biological activities, potentially serving as intermediates in pharmaceutical synthesis or as active pharmaceutical ingredients. The molecular structure indicates that it may have moderate polarity, which can affect its interaction with biological systems. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-[4-(3-amino-2-hydroxy-propoxy)phenyl]acetamide is of interest in medicinal chemistry and may warrant further investigation for its therapeutic potential.
Formula:C11H16N2O3
InChI:InChI=1/C11H16N2O3/c12-6-9(14)7-16-10-3-1-8(2-4-10)5-11(13)15/h1-4,9,14H,5-7,12H2,(H2,13,15)
SMILES:c1cc(ccc1CC(=N)O)OCC(CN)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(4-(3-Amino-2-hydroxypropoxy)phenyl)acetamide
CAS:Formula:C11H16N2O3Purity:95%Color and Shape:SolidMolecular weight:224.2563Atenolol EP Impurity J
CAS:Formula:C11H16N2O3Color and Shape:White To Off-White SolidMolecular weight:224.264-(3-Amino-2-hydroxypropoxy)phenylacetamide
CAS:Controlled ProductImpurity Atenolol Impurity 3; Atenolol Impurity 1
Applications Atenolol Impurity 3. Atenolol Impurity 1.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C11H16N2O3Color and Shape:NeatMolecular weight:224.264-(3-Amino-2-hydroxypropoxy)phenylacetamide
CAS:4-(3-Amino-2-hydroxypropoxy)phenylacetamide is a sweetener that is used as an artificial sweetener. It can be found in many foods and drinks and is often used to replace sucralose due to its lower cost. 4-(3-Amino-2-hydroxypropoxy)phenylacetamide is a white powder with a melting point of 133°C. This product has been shown to be safe for human consumption, although it may cause headaches, drowsiness, or dizziness in some people.
Formula:C11H16N2O3Purity:Min. 95%Molecular weight:224.26 g/mol





