CAS 81348-83-6: Momordicoside L

Description:Momordicoside L is a natural compound primarily derived from the fruit of the bitter melon plant, scientifically known as Momordica charantia. It belongs to a class of compounds known as triterpenoid saponins, which are characterized by their complex structure and biological activity. This substance is notable for its potential health benefits, including anti-diabetic, anti-inflammatory, and antioxidant properties. Momordicoside L has been studied for its ability to modulate glucose metabolism and improve insulin sensitivity, making it of interest in the context of diabetes management. Additionally, it may exhibit antimicrobial and anticancer activities, although further research is needed to fully understand its mechanisms and efficacy. The compound is typically soluble in water and exhibits a bitter taste, which is characteristic of many saponins. As with other bioactive compounds, the safety and dosage of Momordicoside L should be considered, particularly in therapeutic applications. Overall, its diverse biological activities make it a subject of interest in both traditional medicine and modern pharmacological research.

Formula:C₃₆H₅₈O₉

InChI:InChI=1S/C36H58O9/c1-20(9-8-13-32(2,3)43)21-12-14-35(7)30-24(44-31-29(42)28(41)27(40)25(18-37)45-31)17-23-22(10-11-26(39)33(23,4)5)36(30,19-38)16-15-34(21,35)6/h8,13,17,19-22,24-31,37,39-43H,9-12,14-16,18H2,1-7H3/b13-8+/t20-,21-,22-,24+,25-,26+,27-,28+,29-,30+,31-,34-,35+,36-/m1/s1

InChI key:InChIKey=BOHOBTRHAFBJOW-MLFDEFIASA-N

SMILES:O=CC12CCC3(C)C(CCC3(C)C2C(OC4OC(CO)C(O)C(O)C4O)C=C5C1CCC(O)C5(C)C)C(C)CC=CC(O)(C)C

Synonyms:
19-Norlanosta-5,23-diene-9-carboxaldehyde, 7-(β-D-glucopyranosyloxy)-3,25-dihydroxy-, (3β,7β,9β,10α,23E)-
Momordicoside L
(3β,7β,9β,10α,23E)-7-(β-D-Glucopyranosyloxy)-3,25-dihydroxy-19-norlanosta-5,23-diene-9-carboxaldehyde