CymitQuimica logo

CAS 81353-09-5

:

3-hydroxy-2-(4-methoxyphenyl)-5-[2-(methylamino)ethyl]-2,3-dihydro-1,5-benzothiazepin-4(5H)-one

Description:
3-Hydroxy-2-(4-methoxyphenyl)-5-[2-(methylamino)ethyl]-2,3-dihydro-1,5-benzothiazepin-4(5H)-one, with the CAS number 81353-09-5, is a chemical compound characterized by its complex structure, which includes a benzothiazepine core. This compound features a hydroxyl group and a methoxyphenyl substituent, contributing to its potential biological activity. The presence of a methylamino group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The benzothiazepine framework is known for its diverse pharmacological properties, including anxiolytic and antihypertensive effects. The compound's solubility, stability, and reactivity can be influenced by the functional groups attached to the core structure. Additionally, its molecular weight and specific stereochemistry may affect its pharmacokinetics and pharmacodynamics. Overall, this compound represents a class of molecules that may have therapeutic applications, warranting further investigation into its biological effects and potential uses in drug development.
Formula:C19H22N2O3S
InChI:InChI=1/C19H22N2O3S/c1-20-11-12-21-15-5-3-4-6-16(15)25-18(17(22)19(21)23)13-7-9-14(24-2)10-8-13/h3-10,17-18,20,22H,11-12H2,1-2H3
SMILES:CNCCN1c2ccccc2SC(c2ccc(cc2)OC)C(C1=O)O
Synonyms:
  • 1,5-benzothiazepin-4(5H)-one, 2,3-dihydro-3-hydroxy-2-(4-methoxyphenyl)-5-[2-(methylamino)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.