CAS 813530-45-9

N-[(5-Bromo-2-thienyl)sulfonyl]-L-valine

Description:

N-[(5-Bromo-2-thienyl)sulfonyl]-L-valine is a chemical compound characterized by its unique structure, which includes a thienyl group and a sulfonyl moiety attached to the amino acid L-valine. The presence of the bromine atom on the thienyl ring enhances its reactivity and may influence its biological activity. This compound is typically classified as a sulfonamide, which are known for their diverse applications in medicinal chemistry, particularly as antibacterial agents. The sulfonyl group contributes to the compound's solubility and stability, while the L-valine component provides chirality, potentially affecting its interaction with biological targets. The compound's molecular interactions may be influenced by the electronic properties of the bromine and thienyl groups, making it a subject of interest in drug design and development. Additionally, its specific CAS number, 813530-45-9, allows for precise identification in chemical databases, facilitating research and application in various scientific fields. Overall, N-[(5-Bromo-2-thienyl)sulfonyl]-L-valine represents a complex structure with potential pharmacological significance.

Formula: C₉H₁₂BrNO₄S₂

InChI: InChI=1S/C9H12BrNO4S2/c1-5(2)8(9(12)13)11-17(14,15)7-4-3-6(10)16-7/h3-5,8,11H,1-2H3,(H,12,13)/t8-/m0/s1

InChI key: InChIKey=DIFCADKEDMZWJM-QMMMGPOBSA-N

SMILES: S(N[C@@H](C(C)C)C(O)=O)(=O)(=O)C1=CC=C(Br)S1

Synonyms:

• N-[(5-Bromo-2-thienyl)sulfonyl]-L-valine
• (2S)-2-(5-Bromothiophene-2-sulfonamido)-3-methylbutanoic acid
• L-Valine, N-[(5-bromo-2-thienyl)sulfonyl]-