CAS 81357-18-8
:4-Oxo-1,2-piperidinedicarboxylic acid 1-(tert-butyl) 2-methyl ester
Description:
4-Oxo-1,2-piperidinedicarboxylic acid 1-(tert-butyl) 2-methyl ester, with CAS number 81357-18-8, is a chemical compound characterized by its piperidine ring structure, which is a six-membered cyclic amine. This compound features two carboxylic acid groups that are esterified, one of which is substituted with a tert-butyl group, enhancing its hydrophobic properties. The presence of the 4-oxo group indicates a carbonyl functionality, contributing to its reactivity and potential applications in organic synthesis. The methyl ester group further modifies its solubility and reactivity, making it useful in various chemical reactions, including esterification and amidation. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Its stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, this compound serves as a versatile intermediate in the synthesis of more complex molecules in pharmaceutical and chemical research.
Formula:C12H19NO5
InChI:InChI=1/C12H19NO5/c1-12(2,3)18-11(16)13-6-5-8(14)7-9(13)10(15)17-4/h9H,5-7H2,1-4H3
SMILES:CC(C)(C)OC(=O)N1CCC(=O)CC1C(=O)OC
Synonyms:- 1,2-Piperidinedicarboxylic acid, 4-oxo-, 1-(1,1-dimethylethyl) 2-methyl ester
- 1-tert-Butyl 2-methyl 4-oxopiperidine-1,2-dicarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2-Piperidinedicarboxylicacid, 4-oxo-, 1-(1,1-dimethylethyl) 2-methyl ester
CAS:Formula:C12H19NO5Purity:96%Color and Shape:SolidMolecular weight:257.2830Ref: IN-DA0038FG
1g49.00€5g118.00€10g190.00€25g279.00€100gTo inquire100mg25.00€250mg28.00€500mg43.00€1-tert-Butyl 2-methyl 4-oxopiperidine-1,2-dicarboxylate
CAS:1-tert-Butyl 2-methyl 4-oxopiperidine-1,2-dicarboxylateFormula:C12H19NO5Purity:97%Color and Shape: white to off-white solidMolecular weight:257.28296g/mol1-tert-Butyl 2-methyl 4-oxopiperidine-1,2-dicarboxylate
CAS:Formula:C12H19NO5Purity:95%Color and Shape:SolidMolecular weight:257.2861-tert-Butyl 2-methyl 4-oxopiperidine-1,2-dicarboxylate
CAS:Please enquire for more information about 1-tert-Butyl 2-methyl 4-oxopiperidine-1,2-dicarboxylate including the price, delivery time and more detailed product information at the technical inquiry form on this pagePurity:Min. 95%



