
CAS 81357-29-1
:3-Hydroxy-4-methyl-4-pentenoic acid
Description:
3-Hydroxy-4-methyl-4-pentenoic acid, with the CAS number 81357-29-1, is an organic compound characterized by its unique structure, which includes a hydroxyl group (-OH) and a double bond within a pentenoic acid framework. This compound features a branched chain due to the presence of a methyl group, contributing to its distinct chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of both the hydroxyl and carboxylic acid functional groups suggests that it can participate in various chemical reactions, including esterification and dehydration. Its solubility in polar solvents like water and alcohols indicates its potential applications in biochemical processes and as an intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C6H10O3
InChI:InChI=1S/C6H10O3/c1-4(2)5(7)3-6(8)9/h5,7H,1,3H2,2H3,(H,8,9)
InChI key:InChIKey=FVSIFLIGNROQDR-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(C(C)=C)O
Synonyms:- 4-Methyl-3-hydroxypent-4-enoic acid
- 4-Pentenoic acid, 3-hydroxy-4-methyl-
- 3-Hydroxy-4-methyl-4-pentenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.