CAS 81364-78-5
:2-octadecyl-1H-indole-5-carboxylic acid
Description:
2-Octadecyl-1H-indole-5-carboxylic acid is a chemical compound characterized by its long hydrophobic alkyl chain and an indole moiety, which contributes to its unique properties. The presence of the carboxylic acid functional group imparts acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. This compound is typically used in research and applications related to surfactants, drug delivery systems, and as a potential building block in organic synthesis. Its long alkyl chain enhances its lipophilicity, making it suitable for interactions with lipid membranes and biological systems. Additionally, the indole structure is known for its biological activity, which may include antioxidant and anti-inflammatory properties. The compound's solubility is influenced by the balance between its hydrophobic and hydrophilic regions, affecting its behavior in different solvents. Overall, 2-octadecyl-1H-indole-5-carboxylic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C27H43NO2
InChI:InChI=1/C27H43NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25-22-24-21-23(27(29)30)19-20-26(24)28-25/h19-22,28H,2-18H2,1H3,(H,29,30)
SMILES:CCCCCCCCCCCCCCCCCCc1cc2cc(ccc2[nH]1)C(=O)O
Synonyms:- 1H-indole-5-carboxylic acid, 2-octadecyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Octadecyl-1H-indole-5-carboxylic acid
CAS:2-Octadecyl-1H-indole-5-carboxylic acid is a hypocholesterolaemic drug that is used for the treatment of hypercholesterolaemia. It has been shown to reduce plasma cholesterol and low density lipoprotein (LDL) levels in animals and humans, as well as decrease the size of atherosclerotic lesions in animal models. 2OICC is metabolized by esterases and glucuronidases, which hydrolyze it into octadecanol, indoleacetic acid, and carboxylic acid. The drug binds to human plasma proteins with high affinity and this binding affects its pharmacokinetics. 2OICC has been found to be absorbed through the skin (percutaneous route) after topical application in humans. The compound was also found to have a homologue that was structurally similar with an absorbance at 220 nm. This homologue was also found in rats, rabbits, guFormula:C27H43NO2Purity:Min. 95%Molecular weight:413.64 g/molRP 54275
CAS:RP 54275: natural fatty acid derivative, lowers cholesterol, activates PPARγ for lipid regulation, inflammation, and cell differentiation.Formula:C27H43NO2Purity:98%Color and Shape:SolidMolecular weight:413.64

