
CAS 81376-85-4
:3-Methoxy-α-methyl-2-pyridinemethanol
Description:
3-Methoxy-α-methyl-2-pyridinemethanol, with the CAS number 81376-85-4, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methoxy group (-OCH₃) and a hydroxymethyl group (-CH₂OH) attached to the pyridine ring, contributing to its polar nature and potential for hydrogen bonding. The presence of the α-methyl group enhances its steric properties, influencing its reactivity and interactions with other molecules. Typically, compounds like this may exhibit solubility in polar solvents due to the hydroxyl and methoxy functionalities. The compound may also display biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific applications and behavior in chemical reactions would depend on the context of its use, including potential roles as a ligand or in synthesis pathways. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.
Formula:C8H11NO2
InChI:InChI=1S/C8H11NO2/c1-6(10)8-7(11-2)4-3-5-9-8/h3-6,10H,1-2H3
InChI key:InChIKey=AYSWSFMPOVHZPA-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(C)O)N=CC=C1
Synonyms:- 1-(3-Methoxypyridin-2-yl)ethan-1-ol
- 1-(3-Methoxypyridin-2-yl)ethanol
- 3-Methoxy-α-methyl-2-pyridinemethanol
- 2-Pyridinemethanol, 3-methoxy-α-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.