CymitQuimica logo

CAS 81390-89-8

:

1-(3-chlorophenyl)-1-cyclopropylethanol

Description:
1-(3-Chlorophenyl)-1-cyclopropylethanol, with the CAS number 81390-89-8, is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a chlorophenyl moiety. This compound typically exhibits properties associated with alcohols, such as the ability to form hydrogen bonds due to the presence of the hydroxyl (-OH) group. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The chlorophenyl group may impart certain biological activities, making it of interest in medicinal chemistry and pharmacology. Additionally, the cyclopropyl ring can influence the compound's reactivity and steric properties, potentially affecting its interactions with biological targets. The compound's solubility in organic solvents and its stability under various conditions are also important characteristics to consider for applications in research and industry. Overall, 1-(3-chlorophenyl)-1-cyclopropylethanol represents a versatile structure with potential utility in various chemical and pharmaceutical contexts.
Formula:C11H13ClO
InChI:InChI=1/C11H13ClO/c1-11(13,8-5-6-8)9-3-2-4-10(12)7-9/h2-4,7-8,13H,5-6H2,1H3
SMILES:CC(C1CC1)(c1cccc(c1)Cl)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.