CAS 81395-28-0
:1-Bromo-2-[(phenylmethoxy)methyl]benzene
Description:
1-Bromo-2-[(phenylmethoxy)methyl]benzene, with the CAS number 81395-28-0, is an organic compound characterized by the presence of a bromine atom and a phenylmethoxy group attached to a benzene ring. This compound features a bromo substituent at the second position of the benzene ring, which enhances its reactivity and potential applications in organic synthesis. The phenylmethoxy group contributes to its solubility and stability, making it suitable for various chemical reactions. Typically, compounds of this nature exhibit moderate to high boiling points due to their aromatic structure and molecular weight. They may also display moderate polarity, influencing their interactions with other substances. The presence of the bromine atom can facilitate nucleophilic substitution reactions, while the methoxy group can serve as an electron-donating group, affecting the compound's reactivity. Overall, 1-Bromo-2-[(phenylmethoxy)methyl]benzene is of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C14H13BrO
InChI:InChI=1S/C14H13BrO/c15-14-9-5-4-8-13(14)11-16-10-12-6-2-1-3-7-12/h1-9H,10-11H2
InChI key:InChIKey=VOHVUWKSNPWPQB-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)C2=C(Br)C=CC=C2
Synonyms:- Benzene, 1-bromo-2-[(phenylmethoxy)methyl]-
- 1-Bromo-2-[(phenylmethoxy)methyl]benzene
- 1-[(Benzyloxy)methyl]-2-bromobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Bromo-2-[(phenylmethoxy)methyl]benzene
CAS:Controlled ProductFormula:C14H13BrOColor and Shape:NeatMolecular weight:277.156
